C25H34N6O3 — CID 172568891
2,3-bis(2-methoxyethyl)-N-[(E)-1-(3-methylphenyl)ethylideneamino]-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-amine (PubChem CID 172568891) has the molecular formula C25H34N6O3 and a molecular weight of 466.59 g/mol. Its IUPAC name is 2,3-bis(2-methoxyethyl)-N-[(E)-1-(3-methylphenyl)ethylideneamino]-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2,3-bis(2-methoxyethyl)-N-[(E)-1-(3-methylphenyl)ethylideneamino]-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 172568891 |
| Molecular Formula | C25H34N6O3 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 2,3-bis(2-methoxyethyl)-N-[(E)-1-(3-methylphenyl)ethylideneamino]-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-amine |
| SMILES | COCCc1nc2c(N3CCOCC3)cc(N/N=C(\C)c3cccc(C)c3)nc2n1CCOC |
| InChI | InChI=1S/C25H34N6O3/c1-18-6-5-7-20(16-18)19(2)28-29-22-17-21(30-9-14-34-15-10-30)24-25(26-22)31(11-13-33-4)23(27-24)8-12-32-3/h5-7,16-17H,8-15H2,1-4H3,(H,26,29)/b28-19+ |
| InChIKey | WPPQFAKVQQYGFX-TURZUDJPSA-N |
| XLogP | 3.25 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|