C19H20ClFN6O — CID 172568919
N-[(E)-1-(3-chloro-4-fluorophenyl)ethylideneamino]-3-methyl-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-amine (PubChem CID 172568919) has the molecular formula C19H20ClFN6O and a molecular weight of 402.86 g/mol. Its IUPAC name is N-[(E)-1-(3-chloro-4-fluorophenyl)ethylideneamino]-3-methyl-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-amine.
| Compound Name | N-[(E)-1-(3-chloro-4-fluorophenyl)ethylideneamino]-3-methyl-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 172568919 |
| Molecular Formula | C19H20ClFN6O |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[(E)-1-(3-chloro-4-fluorophenyl)ethylideneamino]-3-methyl-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-amine |
| SMILES | C/C(=N\Nc1cc(N2CCOCC2)c2ncn(C)c2n1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClFN6O/c1-12(13-3-4-15(21)14(20)9-13)24-25-17-10-16(27-5-7-28-8-6-27)18-19(23-17)26(2)11-22-18/h3-4,9-11H,5-8H2,1-2H3,(H,23,25)/b24-12+ |
| InChIKey | ZDKNOOULKRGJAU-WYMPLXKRSA-N |
| XLogP | 3.43 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|