C17H24BClFNO4S — CID 172570346
N-[5-chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentanesulfonamide (PubChem CID 172570346) has the molecular formula C17H24BClFNO4S and a molecular weight of 403.71 g/mol. Its IUPAC name is N-[5-chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentanesulfonamide.
| Compound Name | N-[5-chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentanesulfonamide |
|---|---|
| PubChem CID | 172570346 |
| Molecular Formula | C17H24BClFNO4S |
| Molecular Weight | 403.71 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[5-chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentanesulfonamide |
| SMILES | CC1(C)OB(c2cc(Cl)cc(NS(=O)(=O)C3CCCC3)c2F)OC1(C)C |
| InChI | InChI=1S/C17H24BClFNO4S/c1-16(2)17(3,4)25-18(24-16)13-9-11(19)10-14(15(13)20)21-26(22,23)12-7-5-6-8-12/h9-10,12,21H,5-8H2,1-4H3 |
| InChIKey | VZNYPUVKIGNXMS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.71 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|