C9H11BrN2O2 — CID 172571299
4-amino-2-bromo-3-hydroxy-N,N-dimethylbenzamide (PubChem CID 172571299) has the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. Its IUPAC name is 4-amino-2-bromo-3-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 4-amino-2-bromo-3-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 172571299 |
| Molecular Formula | C9H11BrN2O2 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 4-amino-2-bromo-3-hydroxy-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(N)c(O)c1Br |
| InChI | InChI=1S/C9H11BrN2O2/c1-12(2)9(14)5-3-4-6(11)8(13)7(5)10/h3-4,13H,11H2,1-2H3 |
| InChIKey | OAFKEUBBHYXNRR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|