C12H16O2 — CID 172571436
(1S,2R,4R)-5-ethynyl-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]hept-5-en-2-ol (PubChem CID 172571436) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1S,2R,4R)-5-ethynyl-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]hept-5-en-2-ol.
| Compound Name | (1S,2R,4R)-5-ethynyl-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]hept-5-en-2-ol |
|---|---|
| PubChem CID | 172571436 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1S,2R,4R)-5-ethynyl-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]hept-5-en-2-ol |
| SMILES | C#CC1=C[C@]2(C)O[C@@]1(C(C)C)C[C@H]2O |
| InChI | InChI=1S/C12H16O2/c1-5-9-6-11(4)10(13)7-12(9,14-11)8(2)3/h1,6,8,10,13H,7H2,2-4H3/t10-,11+,12-/m1/s1 |
| InChIKey | VHFIAFACTAYTDX-GRYCIOLGSA-N |
| XLogP | 1.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|