C52H106N4O6 — CID 172572378
[5-[3-aminopropyl-[4-[3-aminopropyl-[5-(2-hexyldecanoyloxy)-2-hydroxypentyl]amino]butyl]amino]-4-hydroxypentyl] 2-hexyldecanoate (PubChem CID 172572378) has the molecular formula C52H106N4O6 and a molecular weight of 883.44 g/mol. Its IUPAC name is [5-[3-aminopropyl-[4-[3-aminopropyl-[5-(2-hexyldecanoyloxy)-2-hydroxypentyl]amino]butyl]amino]-4-hydroxypentyl] 2-hexyldecanoate.
| Compound Name | [5-[3-aminopropyl-[4-[3-aminopropyl-[5-(2-hexyldecanoyloxy)-2-hydroxypentyl]amino]butyl]amino]-4-hydroxypentyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 172572378 |
| Molecular Formula | C52H106N4O6 |
| Molecular Weight | 883.44 g/mol |
| Exact Mass | 882.81 |
| IUPAC Name | [5-[3-aminopropyl-[4-[3-aminopropyl-[5-(2-hexyldecanoyloxy)-2-hydroxypentyl]amino]butyl]amino]-4-hydroxypentyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCC(O)CN(CCCN)CCCCN(CCCN)CC(O)CCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C52H106N4O6/c1-5-9-13-17-19-23-33-47(31-21-15-11-7-3)51(59)61-43-27-35-49(57)45-55(41-29-37-53)39-25-26-40-56(42-30-38-54)46-50(58)36-28-44-62-52(60)48(32-22-16-12-8-4)34-24-20-18-14-10-6-2/h47-50,57-58H,5-46,53-54H2,1-4H3 |
| InChIKey | OLWLCKYYLIFRBP-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 151.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.44 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|