About 4-ethoxy-2-fluoro-5,7-dihydrothieno[3,4-d]pyrimidine
4-ethoxy-2-fluoro-5,7-dihydrothieno[3,4-d]pyrimidine (PubChem CID 172576535) has the molecular formula C8H9FN2OS
and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-ethoxy-2-fluoro-5,7-dihydrothieno[3,4-d]pyrimidine.
Analyze 4-ethoxy-2-fluoro-5,7-dihydrothieno[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-2-fluoro-5,7-dihydrothieno[3,4-d]pyrimidine?
The IUPAC name of 4-ethoxy-2-fluoro-5,7-dihydrothieno[3,4-d]pyrimidine (CID 172576535) is 4-ethoxy-2-fluoro-5,7-dihydrothieno[3,4-d]pyrimidine.
What is the SMILES notation for 4-ethoxy-2-fluoro-5,7-dihydrothieno[3,4-d]pyrimidine?
The canonical SMILES for 4-ethoxy-2-fluoro-5,7-dihydrothieno[3,4-d]pyrimidine is CCOc1nc(F)nc2c1CSC2.
What is the InChIKey of 4-ethoxy-2-fluoro-5,7-dihydrothieno[3,4-d]pyrimidine?
The InChIKey is GSQCXYAQXSRSPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN2OS/c1-2-12-7-5-3-13-4-6(5)10-8(9)11-7/h2-4H2,1H3.
What are the key properties of 4-ethoxy-2-fluoro-5,7-dihydrothieno[3,4-d]pyrimidine?
4-ethoxy-2-fluoro-5,7-dihydrothieno[3,4-d]pyrimidine has a molecular weight of 200.24 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-2-fluoro-5,7-dihydrothieno[3,4-d]pyrimidine is sourced from PubChem (CID 172576535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).