C8H9ClN2OS — CID 172576400
2-chloro-4-ethoxy-5,7-dihydrothieno[3,4-d]pyrimidine (PubChem CID 172576400) has the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. Its IUPAC name is 2-chloro-4-ethoxy-5,7-dihydrothieno[3,4-d]pyrimidine.
| Compound Name | 2-chloro-4-ethoxy-5,7-dihydrothieno[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 172576400 |
| Molecular Formula | C8H9ClN2OS |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 2-chloro-4-ethoxy-5,7-dihydrothieno[3,4-d]pyrimidine |
| SMILES | CCOc1nc(Cl)nc2c1CSC2 |
| InChI | InChI=1S/C8H9ClN2OS/c1-2-12-7-5-3-13-4-6(5)10-8(9)11-7/h2-4H2,1H3 |
| InChIKey | SLLKCBMTWWMLIZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |