C14H15FN2O7S — CID 172580781
O-[[(3aS,4S,6R,6aR)-6-(2,4-dioxopyrimidin-1-yl)-4-fluoro-2-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl] 2-methylpropanethioate (PubChem CID 172580781) has the molecular formula C14H15FN2O7S and a molecular weight of 374.35 g/mol. Its IUPAC name is O-[[(3aS,4S,6R,6aR)-6-(2,4-dioxopyrimidin-1-yl)-4-fluoro-2-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl] 2-methylpropanethioate.
| Compound Name | O-[[(3aS,4S,6R,6aR)-6-(2,4-dioxopyrimidin-1-yl)-4-fluoro-2-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 172580781 |
| Molecular Formula | C14H15FN2O7S |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | O-[[(3aS,4S,6R,6aR)-6-(2,4-dioxopyrimidin-1-yl)-4-fluoro-2-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl] 2-methylpropanethioate |
| SMILES | CC(C)C(=S)OC[C@@]1(F)O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H]2OC(=O)O[C@@H]21 |
| InChI | InChI=1S/C14H15FN2O7S/c1-6(2)11(25)21-5-14(15)9-8(22-13(20)23-9)10(24-14)17-4-3-7(18)16-12(17)19/h3-4,6,8-10H,5H2,1-2H3,(H,16,18,19)/t8-,9+,10-,14-/m1/s1 |
| InChIKey | UCMQPDAOBZJGOP-QOBXEIRBSA-N |
| XLogP | 0.64 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|