C19H15FN2O8 — CID 177261112
[(3aS,4S,6R,6aR)-6-(2,4-dioxopyrimidin-1-yl)-4-fluoro-2-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl (E)-3-phenylprop-2-enoate (PubChem CID 177261112) has the molecular formula C19H15FN2O8 and a molecular weight of 418.33 g/mol. Its IUPAC name is [(3aS,4S,6R,6aR)-6-(2,4-dioxopyrimidin-1-yl)-4-fluoro-2-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl (E)-3-phenylprop-2-enoate.
| Compound Name | [(3aS,4S,6R,6aR)-6-(2,4-dioxopyrimidin-1-yl)-4-fluoro-2-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 177261112 |
| Molecular Formula | C19H15FN2O8 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [(3aS,4S,6R,6aR)-6-(2,4-dioxopyrimidin-1-yl)-4-fluoro-2-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OC[C@@]1(F)O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H]2OC(=O)O[C@@H]21 |
| InChI | InChI=1S/C19H15FN2O8/c20-19(10-27-13(24)7-6-11-4-2-1-3-5-11)15-14(28-18(26)29-15)16(30-19)22-9-8-12(23)21-17(22)25/h1-9,14-16H,10H2,(H,21,23,25)/b7-6+/t14-,15+,16-,19-/m1/s1 |
| InChIKey | NSVKAIGSDMMQRT-WABMZUMLSA-N |
| XLogP | 0.89 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|