C21H20F2N6O — CID 172583116
(4,4-difluoropiperidin-1-yl)-[3-[6-methanimidoyl-5-(methylamino)-2-pyridinyl]quinoxalin-6-yl]methanone (PubChem CID 172583116) has the molecular formula C21H20F2N6O and a molecular weight of 410.43 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[3-[6-methanimidoyl-5-(methylamino)-2-pyridinyl]quinoxalin-6-yl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[3-[6-methanimidoyl-5-(methylamino)-2-pyridinyl]quinoxalin-6-yl]methanone |
|---|---|
| PubChem CID | 172583116 |
| Molecular Formula | C21H20F2N6O |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[3-[6-methanimidoyl-5-(methylamino)-2-pyridinyl]quinoxalin-6-yl]methanone |
| SMILES | [H]/N=C/c1nc(-c2cnc3ccc(C(=O)N4CCC(F)(F)CC4)cc3n2)ccc1NC |
| InChI | InChI=1S/C21H20F2N6O/c1-25-14-4-5-16(27-18(14)11-24)19-12-26-15-3-2-13(10-17(15)28-19)20(30)29-8-6-21(22,23)7-9-29/h2-5,10-12,24-25H,6-9H2,1H3/b24-11+ |
| InChIKey | RDRKDLZVSGKDBW-BHGWPJFGSA-N |
| XLogP | 3.60 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|