About 7-fluoro-2,7-dimethyl-5-oxa-2-azaspiro[3.4]octane
7-fluoro-2,7-dimethyl-5-oxa-2-azaspiro[3.4]octane (PubChem CID 172583131) has the molecular formula C8H14FNO
and a molecular weight of 159.20 g/mol. Its IUPAC name is 7-fluoro-2,7-dimethyl-5-oxa-2-azaspiro[3.4]octane.
Analyze 7-fluoro-2,7-dimethyl-5-oxa-2-azaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2,7-dimethyl-5-oxa-2-azaspiro[3.4]octane?
The IUPAC name of 7-fluoro-2,7-dimethyl-5-oxa-2-azaspiro[3.4]octane (CID 172583131) is 7-fluoro-2,7-dimethyl-5-oxa-2-azaspiro[3.4]octane.
What is the SMILES notation for 7-fluoro-2,7-dimethyl-5-oxa-2-azaspiro[3.4]octane?
The canonical SMILES for 7-fluoro-2,7-dimethyl-5-oxa-2-azaspiro[3.4]octane is CN1CC2(C1)CC(C)(F)CO2.
What is the InChIKey of 7-fluoro-2,7-dimethyl-5-oxa-2-azaspiro[3.4]octane?
The InChIKey is HXBGHPGXRVUVCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14FNO/c1-7(9)3-8(11-6-7)4-10(2)5-8/h3-6H2,1-2H3.
What are the key properties of 7-fluoro-2,7-dimethyl-5-oxa-2-azaspiro[3.4]octane?
7-fluoro-2,7-dimethyl-5-oxa-2-azaspiro[3.4]octane has a molecular weight of 159.20 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2,7-dimethyl-5-oxa-2-azaspiro[3.4]octane is sourced from PubChem (CID 172583131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).