C29H24ClF3N4O7 — CID 172593933
methyl 4-[bis[(4-methoxyphenyl)methyl]amino]-1-[2-chloro-6-nitro-4-(trifluoromethyl)phenyl]-6-oxopyrimidine-5-carboxylate (PubChem CID 172593933) has the molecular formula C29H24ClF3N4O7 and a molecular weight of 632.98 g/mol. Its IUPAC name is methyl 4-[bis[(4-methoxyphenyl)methyl]amino]-1-[2-chloro-6-nitro-4-(trifluoromethyl)phenyl]-6-oxopyrimidine-5-carboxylate.
| Compound Name | methyl 4-[bis[(4-methoxyphenyl)methyl]amino]-1-[2-chloro-6-nitro-4-(trifluoromethyl)phenyl]-6-oxopyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 172593933 |
| Molecular Formula | C29H24ClF3N4O7 |
| Molecular Weight | 632.98 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | methyl 4-[bis[(4-methoxyphenyl)methyl]amino]-1-[2-chloro-6-nitro-4-(trifluoromethyl)phenyl]-6-oxopyrimidine-5-carboxylate |
| SMILES | COC(=O)c1c(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)ncn(-c2c(Cl)cc(C(F)(F)F)cc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C29H24ClF3N4O7/c1-42-20-8-4-17(5-9-20)14-35(15-18-6-10-21(43-2)11-7-18)26-24(28(39)44-3)27(38)36(16-34-26)25-22(30)12-19(29(31,32)33)13-23(25)37(40)41/h4-13,16H,14-15H2,1-3H3 |
| InChIKey | GITZSYVNCNHHKQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 126.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.98 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|