C12H7ClF3N3O4 — CID 19915805
1-[2-chloro-6-nitro-4-(trifluoromethyl)phenyl]-5-methoxypyrazin-2-one (PubChem CID 19915805) has the molecular formula C12H7ClF3N3O4 and a molecular weight of 349.65 g/mol. Its IUPAC name is 1-[2-chloro-6-nitro-4-(trifluoromethyl)phenyl]-5-methoxypyrazin-2-one.
| Compound Name | 1-[2-chloro-6-nitro-4-(trifluoromethyl)phenyl]-5-methoxypyrazin-2-one |
|---|---|
| PubChem CID | 19915805 |
| Molecular Formula | C12H7ClF3N3O4 |
| Molecular Weight | 349.65 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 1-[2-chloro-6-nitro-4-(trifluoromethyl)phenyl]-5-methoxypyrazin-2-one |
| SMILES | COc1cn(-c2c(Cl)cc(C(F)(F)F)cc2[N+](=O)[O-])c(=O)cn1 |
| InChI | InChI=1S/C12H7ClF3N3O4/c1-23-9-5-18(10(20)4-17-9)11-7(13)2-6(12(14,15)16)3-8(11)19(21)22/h2-5H,1H3 |
| InChIKey | YQUVENHNHTVUCT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.65 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|