C13H8ClF3N2O5P+ — CID 70457047
[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-methyl-2-nitrophenyl]-hydroxy-oxophosphanium (PubChem CID 70457047) has the molecular formula C13H8ClF3N2O5P+ and a molecular weight of 395.64 g/mol. Its IUPAC name is [5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-methyl-2-nitrophenyl]-hydroxy-oxophosphanium.
| Compound Name | [5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-methyl-2-nitrophenyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 70457047 |
| Molecular Formula | C13H8ClF3N2O5P+ |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | [5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-methyl-2-nitrophenyl]-hydroxy-oxophosphanium |
| SMILES | Cc1cc([N+](=O)[O-])c([P+](=O)O)cc1Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H7ClF3N2O5P/c1-6-2-9(19(20)21)11(25(22)23)4-10(6)24-12-8(14)3-7(5-18-12)13(15,16)17/h2-5H,1H3/p+1 |
| InChIKey | NHFGXCPHACERKE-UHFFFAOYSA-O |
| XLogP | 4.12 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|