C25H33N9O7S — CID 172595481
(4S)-5-[[(2S)-1-[(2-cyano-1,3-benzothiazol-6-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-[3-[(2-methoxyacetyl)amino]propanoylamino]-5-oxopentanoic acid (PubChem CID 172595481) has the molecular formula C25H33N9O7S and a molecular weight of 603.66 g/mol. Its IUPAC name is (4S)-5-[[(2S)-1-[(2-cyano-1,3-benzothiazol-6-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-[3-[(2-methoxyacetyl)amino]propanoylamino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-[[(2S)-1-[(2-cyano-1,3-benzothiazol-6-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-[3-[(2-methoxyacetyl)amino]propanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 172595481 |
| Molecular Formula | C25H33N9O7S |
| Molecular Weight | 603.66 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | (4S)-5-[[(2S)-1-[(2-cyano-1,3-benzothiazol-6-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-[3-[(2-methoxyacetyl)amino]propanoylamino]-5-oxopentanoic acid |
| SMILES | COCC(=O)NCCC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)Nc1ccc2nc(C#N)sc2c1 |
| InChI | InChI=1S/C25H33N9O7S/c1-41-13-20(36)29-10-8-19(35)32-17(6-7-22(37)38)24(40)34-16(3-2-9-30-25(27)28)23(39)31-14-4-5-15-18(11-14)42-21(12-26)33-15/h4-5,11,16-17H,2-3,6-10,13H2,1H3,(H,29,36)(H,31,39)(H,32,35)(H,34,40)(H,37,38)(H4,27,28,30)/t16-,17-/m0/s1 |
| InChIKey | WMOQHSVPBMXPOV-IRXDYDNUSA-N |
| XLogP | -0.85 |
| TPSA | 264.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.66 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|