C40H50FN5O3 — CID 172596432
4-[(5Z)-6-butan-2-ylimino-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[2-(2-hydroxypropan-2-yl)azetidin-1-yl]quinazolin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol (PubChem CID 172596432) has the molecular formula C40H50FN5O3 and a molecular weight of 667.87 g/mol. Its IUPAC name is 4-[(5Z)-6-butan-2-ylimino-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[2-(2-hydroxypropan-2-yl)azetidin-1-yl]quinazolin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[(5Z)-6-butan-2-ylimino-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[2-(2-hydroxypropan-2-yl)azetidin-1-yl]quinazolin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 172596432 |
| Molecular Formula | C40H50FN5O3 |
| Molecular Weight | 667.87 g/mol |
| Exact Mass | 667.39 |
| IUPAC Name | 4-[(5Z)-6-butan-2-ylimino-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[2-(2-hydroxypropan-2-yl)azetidin-1-yl]quinazolin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol |
| SMILES | C/C=C1C(=N/C(C)CC)\C(c2cc(O)cc3ccc(F)c(CC)c23)=Cc2nc(OCC34CCCN3CCC4)nc(N3CCC3C(C)(C)O)c2\1 |
| InChI | InChI=1S/C40H50FN5O3/c1-7-24(4)42-36-28(9-3)35-32(22-30(36)29-21-26(47)20-25-12-13-31(41)27(8-2)34(25)29)43-38(44-37(35)46-19-14-33(46)39(5,6)48)49-23-40-15-10-17-45(40)18-11-16-40/h9,12-13,20-22,24,33,47-48H,7-8,10-11,14-19,23H2,1-6H3/b28-9-,42-36+ |
| InChIKey | LOKBAFYVUCEUJU-YXLIEIQFSA-N |
| XLogP | 7.59 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.87 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|