C33H51BrN6O3S — CID 172596555
(5Z)-7-bromo-N-butan-2-yl-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[8-[2-(methoxymethoxy)propyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]quinazolin-6-imine;sulfane (PubChem CID 172596555) has the molecular formula C33H51BrN6O3S and a molecular weight of 691.78 g/mol. Its IUPAC name is (5Z)-7-bromo-N-butan-2-yl-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[8-[2-(methoxymethoxy)propyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]quinazolin-6-imine;sulfane.
| Compound Name | (5Z)-7-bromo-N-butan-2-yl-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[8-[2-(methoxymethoxy)propyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]quinazolin-6-imine;sulfane |
|---|---|
| PubChem CID | 172596555 |
| Molecular Formula | C33H51BrN6O3S |
| Molecular Weight | 691.78 g/mol |
| Exact Mass | 690.29 |
| IUPAC Name | (5Z)-7-bromo-N-butan-2-yl-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[8-[2-(methoxymethoxy)propyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]quinazolin-6-imine;sulfane |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(OCC34CCCN3CCC4)nc(N3CC4CCC(C3)N4CC(C)OCOC)c2\1.S |
| InChI | InChI=1S/C33H49BrN6O3.H2S/c1-6-22(3)35-30-26(7-2)29-28(16-27(30)34)36-32(42-20-33-12-8-14-39(33)15-9-13-33)37-31(29)38-18-24-10-11-25(19-38)40(24)17-23(4)43-21-41-5;/h7,16,22-25H,6,8-15,17-21H2,1-5H3;1H2/b26-7-,35-30-; |
| InChIKey | MKFCQVWKOVROPY-VZZAQGASSA-N |
| XLogP | 5.65 |
| TPSA | 75.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.78 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|