C29H42BrN5O2 — CID 172596113
(3R)-1-[(5Z)-7-bromo-6-butan-2-ylimino-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-8-methylquinazolin-4-yl]-3-methylpiperidin-3-ol (PubChem CID 172596113) has the molecular formula C29H42BrN5O2 and a molecular weight of 572.59 g/mol. Its IUPAC name is (3R)-1-[(5Z)-7-bromo-6-butan-2-ylimino-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-8-methylquinazolin-4-yl]-3-methylpiperidin-3-ol.
| Compound Name | (3R)-1-[(5Z)-7-bromo-6-butan-2-ylimino-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-8-methylquinazolin-4-yl]-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 172596113 |
| Molecular Formula | C29H42BrN5O2 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | (3R)-1-[(5Z)-7-bromo-6-butan-2-ylimino-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-8-methylquinazolin-4-yl]-3-methylpiperidin-3-ol |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=C(C)c2nc(OCC34CCCN3CCC4)nc(N3CCC[C@@](C)(O)C3)c2\1 |
| InChI | InChI=1S/C29H42BrN5O2/c1-6-19(3)31-25-21(7-2)22-24(20(4)23(25)30)32-27(33-26(22)34-14-8-11-28(5,36)17-34)37-18-29-12-9-15-35(29)16-10-13-29/h7,19,36H,6,8-18H2,1-5H3/b21-7-,31-25-/t19?,28-/m1/s1 |
| InChIKey | RIMUWYQTNSMPLR-VDUJHWRESA-N |
| XLogP | 5.62 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|