C17H24N4 — CID 172597481
4-(azepan-1-yl)-5-ethyl-2,7-dimethylpyrido[4,3-d]pyrimidine (PubChem CID 172597481) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-(azepan-1-yl)-5-ethyl-2,7-dimethylpyrido[4,3-d]pyrimidine.
| Compound Name | 4-(azepan-1-yl)-5-ethyl-2,7-dimethylpyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 172597481 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-(azepan-1-yl)-5-ethyl-2,7-dimethylpyrido[4,3-d]pyrimidine |
| SMILES | CCc1nc(C)cc2nc(C)nc(N3CCCCCC3)c12 |
| InChI | InChI=1S/C17H24N4/c1-4-14-16-15(11-12(2)18-14)19-13(3)20-17(16)21-9-7-5-6-8-10-21/h11H,4-10H2,1-3H3 |
| InChIKey | QHTDHGZXSCEYQE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |