C14H18N4O — CID 170726653
(12S)-13-ethyl-3,7,12-trimethyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene (PubChem CID 170726653) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is (12S)-13-ethyl-3,7,12-trimethyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene.
| Compound Name | (12S)-13-ethyl-3,7,12-trimethyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
|---|---|
| PubChem CID | 170726653 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (12S)-13-ethyl-3,7,12-trimethyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
| SMILES | CCN1c2nc(C)nc3cc(C)nc(c23)OC[C@@H]1C |
| InChI | InChI=1S/C14H18N4O/c1-5-18-9(3)7-19-14-12-11(6-8(2)15-14)16-10(4)17-13(12)18/h6,9H,5,7H2,1-4H3/t9-/m0/s1 |
| InChIKey | OSNSVLNYVONMNE-VIFPVBQESA-N |
| XLogP | 2.25 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |