C16H22N4O — CID 172597557
11,15-dimethyl-7-oxa-2,10,14,16-tetrazatetracyclo[7.7.1.02,5.013,17]heptadeca-1(16),9,11,13(17),14-pentaene;ethane (PubChem CID 172597557) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 11,15-dimethyl-7-oxa-2,10,14,16-tetrazatetracyclo[7.7.1.02,5.013,17]heptadeca-1(16),9,11,13(17),14-pentaene;ethane.
| Compound Name | 11,15-dimethyl-7-oxa-2,10,14,16-tetrazatetracyclo[7.7.1.02,5.013,17]heptadeca-1(16),9,11,13(17),14-pentaene;ethane |
|---|---|
| PubChem CID | 172597557 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 11,15-dimethyl-7-oxa-2,10,14,16-tetrazatetracyclo[7.7.1.02,5.013,17]heptadeca-1(16),9,11,13(17),14-pentaene;ethane |
| SMILES | CC.Cc1cc2nc(C)nc3c2c(n1)COCC1CCN31 |
| InChI | InChI=1S/C14H16N4O.C2H6/c1-8-5-11-13-12(15-8)7-19-6-10-3-4-18(10)14(13)17-9(2)16-11;1-2/h5,10H,3-4,6-7H2,1-2H3;1-2H3 |
| InChIKey | VLLPYUBQRWNGQQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |