C18H26N4 — CID 172597725
12,16-dimethyl-2,11,15,17-tetrazatetracyclo[8.7.1.02,8.014,18]octadeca-1(17),10,12,14(18),15-pentaene;ethane (PubChem CID 172597725) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 12,16-dimethyl-2,11,15,17-tetrazatetracyclo[8.7.1.02,8.014,18]octadeca-1(17),10,12,14(18),15-pentaene;ethane.
| Compound Name | 12,16-dimethyl-2,11,15,17-tetrazatetracyclo[8.7.1.02,8.014,18]octadeca-1(17),10,12,14(18),15-pentaene;ethane |
|---|---|
| PubChem CID | 172597725 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 12,16-dimethyl-2,11,15,17-tetrazatetracyclo[8.7.1.02,8.014,18]octadeca-1(17),10,12,14(18),15-pentaene;ethane |
| SMILES | CC.Cc1cc2nc(C)nc3c2c(n1)CC1CCCCCN31 |
| InChI | InChI=1S/C16H20N4.C2H6/c1-10-8-13-15-14(17-10)9-12-6-4-3-5-7-20(12)16(15)19-11(2)18-13;1-2/h8,12H,3-7,9H2,1-2H3;1-2H3 |
| InChIKey | SIJZNFDUEFWQSK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |