C13H16N4O — CID 170726457
3,7,12,13-tetramethyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene (PubChem CID 170726457) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 3,7,12,13-tetramethyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene.
| Compound Name | 3,7,12,13-tetramethyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
|---|---|
| PubChem CID | 170726457 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3,7,12,13-tetramethyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
| SMILES | Cc1cc2nc(C)nc3c2c(n1)OCC(C)N3C |
| InChI | InChI=1S/C13H16N4O/c1-7-5-10-11-12(16-9(3)15-10)17(4)8(2)6-18-13(11)14-7/h5,8H,6H2,1-4H3 |
| InChIKey | ALUKGGFXJCFFIH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |