C18H27KN4O — CID 170726825
CID 170726825 (PubChem CID 170726825) has the molecular formula C18H27KN4O and a molecular weight of 354.54 g/mol.
| Compound Name | CID 170726825 |
|---|---|
| PubChem CID | 170726825 |
| Molecular Formula | C18H27KN4O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | — |
| SMILES | C=CC1COc2nc(C)cc3n[c-]nc(c23)N1CC.CC.CC.[K+] |
| InChI | InChI=1S/C14H15N4O.2C2H6.K/c1-4-10-7-19-14-12-11(6-9(3)17-14)15-8-16-13(12)18(10)5-2;2*1-2;/h4,6,10H,1,5,7H2,2-3H3;2*1-2H3;/q-1;;;+1 |
| InChIKey | QESYPDAKIRXIPP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|