C20H27NO3S — CID 172603988
2-ethylhexyl 3-[(4-formyl-1H-indol-7-yl)sulfanyl]propanoate (PubChem CID 172603988) has the molecular formula C20H27NO3S and a molecular weight of 361.51 g/mol. Its IUPAC name is 2-ethylhexyl 3-[(4-formyl-1H-indol-7-yl)sulfanyl]propanoate.
| Compound Name | 2-ethylhexyl 3-[(4-formyl-1H-indol-7-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 172603988 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-ethylhexyl 3-[(4-formyl-1H-indol-7-yl)sulfanyl]propanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1ccc(C=O)c2cc[nH]c12 |
| InChI | InChI=1S/C20H27NO3S/c1-3-5-6-15(4-2)14-24-19(23)10-12-25-18-8-7-16(13-22)17-9-11-21-20(17)18/h7-9,11,13,15,21H,3-6,10,12,14H2,1-2H3 |
| InChIKey | UDMHPUKQLXPPRM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|