C22H10Br4ClN3O5 — CID 17260457
N-[(4-chlorophenyl)methyl]-3-nitro-N-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 17260457) has the molecular formula C22H10Br4ClN3O5 and a molecular weight of 751.41 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-3-nitro-N-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-3-nitro-N-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 17260457 |
| Molecular Formula | C22H10Br4ClN3O5 |
| Molecular Weight | 751.41 g/mol |
| Exact Mass | 746.70 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-3-nitro-N-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N(Cc1ccc(Cl)cc1)N1C(=O)c2c(Br)c(Br)c(Br)c(Br)c2C1=O |
| InChI | InChI=1S/C22H10Br4ClN3O5/c23-16-14-15(17(24)19(26)18(16)25)22(33)29(21(14)32)28(9-10-4-6-12(27)7-5-10)20(31)11-2-1-3-13(8-11)30(34)35/h1-8H,9H2 |
| InChIKey | XPWIZPICQZDKHU-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.41 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|