C22H13N5O9 — CID 17258969
3-nitro-N-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[(2-nitrophenyl)methyl]benzamide (PubChem CID 17258969) has the molecular formula C22H13N5O9 and a molecular weight of 491.37 g/mol. Its IUPAC name is 3-nitro-N-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[(2-nitrophenyl)methyl]benzamide.
| Compound Name | 3-nitro-N-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[(2-nitrophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 17258969 |
| Molecular Formula | C22H13N5O9 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | 3-nitro-N-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[(2-nitrophenyl)methyl]benzamide |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N(Cc1ccccc1[N+](=O)[O-])N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C22H13N5O9/c28-20(13-6-3-7-15(11-13)25(31)32)23(12-14-5-1-2-9-17(14)26(33)34)24-21(29)16-8-4-10-18(27(35)36)19(16)22(24)30/h1-11H,12H2 |
| InChIKey | NQPFTJPGSWRTBO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 187.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|