C23H25N3O4S2 — CID 172609198
ethyl 2-[[2-[4-(2-cyanopropan-2-yl)-2-pyridinyl]-1H-indol-5-yl]sulfanyl]-4-hydroxysulfanyloxybutanoate (PubChem CID 172609198) has the molecular formula C23H25N3O4S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is ethyl 2-[[2-[4-(2-cyanopropan-2-yl)-2-pyridinyl]-1H-indol-5-yl]sulfanyl]-4-hydroxysulfanyloxybutanoate.
| Compound Name | ethyl 2-[[2-[4-(2-cyanopropan-2-yl)-2-pyridinyl]-1H-indol-5-yl]sulfanyl]-4-hydroxysulfanyloxybutanoate |
|---|---|
| PubChem CID | 172609198 |
| Molecular Formula | C23H25N3O4S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | ethyl 2-[[2-[4-(2-cyanopropan-2-yl)-2-pyridinyl]-1H-indol-5-yl]sulfanyl]-4-hydroxysulfanyloxybutanoate |
| SMILES | CCOC(=O)C(CCOSO)Sc1ccc2[nH]c(-c3cc(C(C)(C)C#N)ccn3)cc2c1 |
| InChI | InChI=1S/C23H25N3O4S2/c1-4-29-22(27)21(8-10-30-32-28)31-17-5-6-18-15(11-17)12-20(26-18)19-13-16(7-9-25-19)23(2,3)14-24/h5-7,9,11-13,21,26,28H,4,8,10H2,1-3H3 |
| InChIKey | FKEMYUMIWBPCGT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|