C13H15F3INO2 — CID 172610174
2-iodo-4-[[(2R)-2-methylmorpholin-4-yl]methyl]-6-(trifluoromethyl)phenol (PubChem CID 172610174) has the molecular formula C13H15F3INO2 and a molecular weight of 401.17 g/mol. Its IUPAC name is 2-iodo-4-[[(2R)-2-methylmorpholin-4-yl]methyl]-6-(trifluoromethyl)phenol.
| Compound Name | 2-iodo-4-[[(2R)-2-methylmorpholin-4-yl]methyl]-6-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 172610174 |
| Molecular Formula | C13H15F3INO2 |
| Molecular Weight | 401.17 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 2-iodo-4-[[(2R)-2-methylmorpholin-4-yl]methyl]-6-(trifluoromethyl)phenol |
| SMILES | C[C@@H]1CN(Cc2cc(I)c(O)c(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C13H15F3INO2/c1-8-6-18(2-3-20-8)7-9-4-10(13(14,15)16)12(19)11(17)5-9/h4-5,8,19H,2-3,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | JEFPZXNBVMFWAP-MRVPVSSYSA-N |
| XLogP | 3.24 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|