C18H22ClN5O3 — CID 172612686
2-chloro-7-methyl-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]prop-2-ynoxy]-9-[(3S)-oxolan-3-yl]purin-8-one (PubChem CID 172612686) has the molecular formula C18H22ClN5O3 and a molecular weight of 391.86 g/mol. Its IUPAC name is 2-chloro-7-methyl-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]prop-2-ynoxy]-9-[(3S)-oxolan-3-yl]purin-8-one.
| Compound Name | 2-chloro-7-methyl-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]prop-2-ynoxy]-9-[(3S)-oxolan-3-yl]purin-8-one |
|---|---|
| PubChem CID | 172612686 |
| Molecular Formula | C18H22ClN5O3 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-chloro-7-methyl-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]prop-2-ynoxy]-9-[(3S)-oxolan-3-yl]purin-8-one |
| SMILES | C#C[C@H](Oc1nc(Cl)nc2c1n(C)c(=O)n2[C@H]1CCOC1)[C@@H]1CCCN1C |
| InChI | InChI=1S/C18H22ClN5O3/c1-4-13(12-6-5-8-22(12)2)27-16-14-15(20-17(19)21-16)24(18(25)23(14)3)11-7-9-26-10-11/h1,11-13H,5-10H2,2-3H3/t11-,12-,13-/m0/s1 |
| InChIKey | MZTQYWQXMQJPEH-AVGNSLFASA-N |
| XLogP | 1.22 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|