C32H44N6O6 — CID 176593898
CID 176593898 (PubChem CID 176593898) has the molecular formula C32H44N6O6 and a molecular weight of 608.74 g/mol.
| Compound Name | CID 176593898 |
|---|---|
| PubChem CID | 176593898 |
| Molecular Formula | C32H44N6O6 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | — |
| SMILES | C[C@H](Oc1nc(-c2onc3c2CCC[C@@]32CCCCC23OCCO3)nc2c1n(C)c(=O)n2[C@@H]1CCCOC1)[C@@H]1CCCN1C |
| InChI | InChI=1S/C32H44N6O6/c1-20(23-11-7-15-36(23)2)43-29-24-28(38(30(39)37(24)3)21-9-8-16-40-19-21)33-27(34-29)25-22-10-6-13-31(26(22)35-44-25)12-4-5-14-32(31)41-17-18-42-32/h20-21,23H,4-19H2,1-3H3/t20-,21+,23-,31-/m0/s1 |
| InChIKey | YJKOHXWDVJNCQX-LIKUKZONSA-N |
| XLogP | 3.89 |
| TPSA | 118.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |