C34H45FN6O6 — CID 176593746
CID 176593746 (PubChem CID 176593746) has the molecular formula C34H45FN6O6 and a molecular weight of 652.77 g/mol.
| Compound Name | CID 176593746 |
|---|---|
| PubChem CID | 176593746 |
| Molecular Formula | C34H45FN6O6 |
| Molecular Weight | 652.77 g/mol |
| Exact Mass | 652.34 |
| IUPAC Name | — |
| SMILES | CCn1c(=O)n([C@@H]2CCCOC2)c2nc(-c3onc4c3CCC[C@@]43CCCCC34OCCO4)nc(OC[C@@]34CCCN3C[C@H](F)C4)c21 |
| InChI | InChI=1S/C34H45FN6O6/c1-2-40-25-29(41(31(40)42)23-8-6-15-43-20-23)36-28(37-30(25)44-21-32-10-7-14-39(32)19-22(35)18-32)26-24-9-5-12-33(27(24)38-47-26)11-3-4-13-34(33)45-16-17-46-34/h22-23H,2-21H2,1H3/t22-,23-,32+,33+/m1/s1 |
| InChIKey | ZUJLIJSEYZETJD-INNFWEGBSA-N |
| XLogP | 4.47 |
| TPSA | 118.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.77 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |