C33H44N6O6 — CID 172612642
CID 172612642 (PubChem CID 172612642) has the molecular formula C33H44N6O6 and a molecular weight of 620.75 g/mol.
| Compound Name | CID 172612642 |
|---|---|
| PubChem CID | 172612642 |
| Molecular Formula | C33H44N6O6 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | — |
| SMILES | C[C@H](Oc1nc(-c2onc3c2CCC[C@@]32CCCCC23OCCO3)nc2c1n(C)c(=O)n2[C@@H]1CC2CCC1O2)[C@@H]1CCCN1C |
| InChI | InChI=1S/C33H44N6O6/c1-19(22-9-7-15-37(22)2)43-30-25-29(39(31(40)38(25)3)23-18-20-10-11-24(23)44-20)34-28(35-30)26-21-8-6-13-32(27(21)36-45-26)12-4-5-14-33(32)41-16-17-42-33/h19-20,22-24H,4-18H2,1-3H3/t19-,20?,22-,23+,24?,32-/m0/s1 |
| InChIKey | SNCVCXZYQSUGOU-HRYBUWPOSA-N |
| XLogP | 4.03 |
| TPSA | 118.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |