About CID 172612642
CID 172612642 (PubChem CID 172612642) has the molecular formula C33H44N6O6
and a molecular weight of 620.75 g/mol.
Molecular Properties
| Compound Name | CID 172612642 |
| PubChem CID | 172612642 |
| Molecular Formula | C33H44N6O6 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | — |
| SMILES | C[C@H](Oc1nc(-c2onc3c2CCC[C@@]32CCCCC23OCCO3)nc2c1n(C)c(=O)n2[C@@H]1CC2CCC1O2)[C@@H]1CCCN1C |
| InChI | InChI=1S/C33H44N6O6/c1-19(22-9-7-15-37(22)2)43-30-25-29(39(31(40)38(25)3)23-18-20-10-11-24(23)44-20)34-28(35-30)26-21-8-6-13-32(27(21)36-45-26)12-4-5-14-33(32)41-16-17-42-33/h19-20,22-24H,4-18H2,1-3H3/t19-,20?,22-,23+,24?,32-/m0/s1 |
| InChIKey | SNCVCXZYQSUGOU-HRYBUWPOSA-N |
| XLogP | 4.03 |
| TPSA | 118.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze CID 172612642 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172612642?
The IUPAC name of CID 172612642 (CID 172612642) is not available.
What is the SMILES notation for CID 172612642?
The canonical SMILES for CID 172612642 is C[C@H](Oc1nc(-c2onc3c2CCC[C@@]32CCCCC23OCCO3)nc2c1n(C)c(=O)n2[C@@H]1CC2CCC1O2)[C@@H]1CCCN1C.
What is the InChIKey of CID 172612642?
The InChIKey is SNCVCXZYQSUGOU-HRYBUWPOSA-N. The full InChI is InChI=1S/C33H44N6O6/c1-19(22-9-7-15-37(22)2)43-30-25-29(39(31(40)38(25)3)23-18-20-10-11-24(23)44-20)34-28(35-30)26-21-8-6-13-32(27(21)36-45-26)12-4-5-14-33(32)41-16-17-42-33/h19-20,22-24H,4-18H2,1-3H3/t19-,20?,22-,23+,24?,32-/m0/s1.
What are the key properties of CID 172612642?
CID 172612642 has a molecular weight of 620.75 g/mol, XLogP of 4.03, 5 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172612642 is sourced from PubChem (CID 172612642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).