C28H40N6O4 — CID 172612775
CID 172612775 (PubChem CID 172612775) has the molecular formula C28H40N6O4 and a molecular weight of 524.67 g/mol.
| Compound Name | CID 172612775 |
|---|---|
| PubChem CID | 172612775 |
| Molecular Formula | C28H40N6O4 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\C)c1c(N)nc(-c2onc3c2CCC[C@@]32CCCCC23OCCO3)nc1O[C@@H](CC)[C@@H]1CCCN1C |
| InChI | InChI=1S/C28H40N6O4/c1-4-20(19-10-8-14-34(19)3)37-26-21(17(2)29)24(30)31-25(32-26)22-18-9-7-12-27(23(18)33-38-22)11-5-6-13-28(27)35-15-16-36-28/h19-20,29H,4-16H2,1-3H3,(H2,30,31,32)/b29-17+/t19-,20-,27-/m0/s1 |
| InChIKey | BJZZZNRUZZIJAH-ACMGXJGWSA-N |
| XLogP | 4.24 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|