C30H40N6O5 — CID 176593858
CID 176593858 (PubChem CID 176593858) has the molecular formula C30H40N6O5 and a molecular weight of 564.69 g/mol.
| Compound Name | CID 176593858 |
|---|---|
| PubChem CID | 176593858 |
| Molecular Formula | C30H40N6O5 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | — |
| SMILES | C[C@H](Oc1nc(-c2onc3c2CCC[C@@]32CCCCC23OCCO3)nc2c1ncn2[C@@H]1CCOC1)[C@@H]1CCCN1C |
| InChI | InChI=1S/C30H40N6O5/c1-19(22-8-6-13-35(22)2)40-28-23-27(36(18-31-23)20-9-14-37-17-20)32-26(33-28)24-21-7-5-11-29(25(21)34-41-24)10-3-4-12-30(29)38-15-16-39-30/h18-20,22H,3-17H2,1-2H3/t19-,20+,22-,29-/m0/s1 |
| InChIKey | BJMIGDQWXUFKFQ-KJIDJHTKSA-N |
| XLogP | 4.20 |
| TPSA | 109.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |