C13H17F3 — CID 172615218
4-methyl-1-[(3Z)-7,7,7-trifluorohepta-1,3-dien-4-yl]cyclopentene (PubChem CID 172615218) has the molecular formula C13H17F3 and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-methyl-1-[(3Z)-7,7,7-trifluorohepta-1,3-dien-4-yl]cyclopentene.
| Compound Name | 4-methyl-1-[(3Z)-7,7,7-trifluorohepta-1,3-dien-4-yl]cyclopentene |
|---|---|
| PubChem CID | 172615218 |
| Molecular Formula | C13H17F3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 4-methyl-1-[(3Z)-7,7,7-trifluorohepta-1,3-dien-4-yl]cyclopentene |
| SMILES | C=C/C=C(/CCC(F)(F)F)C1=CCC(C)C1 |
| InChI | InChI=1S/C13H17F3/c1-3-4-11(7-8-13(14,15)16)12-6-5-10(2)9-12/h3-4,6,10H,1,5,7-9H2,2H3/b11-4- |
| InChIKey | YZUYUOAXTAAZOS-WCIBSUBMSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|