C17H25F2N5O4 — CID 172615791
tert-butyl N-[4-(2,6-difluoro-3-nitrophenyl)-3,4-diiminobutan-2-yl]-N-methylcarbamate;methanamine (PubChem CID 172615791) has the molecular formula C17H25F2N5O4 and a molecular weight of 401.41 g/mol. Its IUPAC name is tert-butyl N-[4-(2,6-difluoro-3-nitrophenyl)-3,4-diiminobutan-2-yl]-N-methylcarbamate;methanamine.
| Compound Name | tert-butyl N-[4-(2,6-difluoro-3-nitrophenyl)-3,4-diiminobutan-2-yl]-N-methylcarbamate;methanamine |
|---|---|
| PubChem CID | 172615791 |
| Molecular Formula | C17H25F2N5O4 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | tert-butyl N-[4-(2,6-difluoro-3-nitrophenyl)-3,4-diiminobutan-2-yl]-N-methylcarbamate;methanamine |
| SMILES | CN.[H]/N=C(C(=N\[H])\C(C)N(C)C(=O)OC(C)(C)C)/c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C16H20F2N4O4.CH5N/c1-8(21(5)15(23)26-16(2,3)4)13(19)14(20)11-9(17)6-7-10(12(11)18)22(24)25;1-2/h6-8,19-20H,1-5H3;2H2,1H3/b19-13+,20-14-; |
| InChIKey | VUSOASGWKLBINJ-PNMGLXAPSA-N |
| XLogP | 3.09 |
| TPSA | 146.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|