C17H21ClFN5O2 — CID 172615962
tert-butyl N-[1-[5-(2-chloro-3-fluoro-4-pyridinyl)-2-methyltriazol-4-yl]cyclobutyl]carbamate (PubChem CID 172615962) has the molecular formula C17H21ClFN5O2 and a molecular weight of 381.84 g/mol. Its IUPAC name is tert-butyl N-[1-[5-(2-chloro-3-fluoro-4-pyridinyl)-2-methyltriazol-4-yl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[5-(2-chloro-3-fluoro-4-pyridinyl)-2-methyltriazol-4-yl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 172615962 |
| Molecular Formula | C17H21ClFN5O2 |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | tert-butyl N-[1-[5-(2-chloro-3-fluoro-4-pyridinyl)-2-methyltriazol-4-yl]cyclobutyl]carbamate |
| SMILES | Cn1nc(-c2ccnc(Cl)c2F)c(C2(NC(=O)OC(C)(C)C)CCC2)n1 |
| InChI | InChI=1S/C17H21ClFN5O2/c1-16(2,3)26-15(25)21-17(7-5-8-17)13-12(22-24(4)23-13)10-6-9-20-14(18)11(10)19/h6,9H,5,7-8H2,1-4H3,(H,21,25) |
| InChIKey | JVMXMPBHJORYMT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|