C26H30N6O — CID 172622973
N-[(1,3-diaminoisoquinolin-6-yl)methyl]-2,5-diethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxamide (PubChem CID 172622973) has the molecular formula C26H30N6O and a molecular weight of 442.57 g/mol. Its IUPAC name is N-[(1,3-diaminoisoquinolin-6-yl)methyl]-2,5-diethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxamide.
| Compound Name | N-[(1,3-diaminoisoquinolin-6-yl)methyl]-2,5-diethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxamide |
|---|---|
| PubChem CID | 172622973 |
| Molecular Formula | C26H30N6O |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | N-[(1,3-diaminoisoquinolin-6-yl)methyl]-2,5-diethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxamide |
| SMILES | CCN1CCc2c(c3cc(C(=O)NCc4ccc5c(N)nc(N)cc5c4)ccc3n2CC)C1 |
| InChI | InChI=1S/C26H30N6O/c1-3-31-10-9-23-21(15-31)20-12-17(6-8-22(20)32(23)4-2)26(33)29-14-16-5-7-19-18(11-16)13-24(27)30-25(19)28/h5-8,11-13H,3-4,9-10,14-15H2,1-2H3,(H,29,33)(H4,27,28,30) |
| InChIKey | AMMZZCSGTLPWGP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|