C26H27N5O2 — CID 172623081
N-[[1-amino-3-(methylamino)isoquinolin-7-yl]methyl]-9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxamide (PubChem CID 172623081) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is N-[[1-amino-3-(methylamino)isoquinolin-7-yl]methyl]-9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[[1-amino-3-(methylamino)isoquinolin-7-yl]methyl]-9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 172623081 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | N-[[1-amino-3-(methylamino)isoquinolin-7-yl]methyl]-9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxamide |
| SMILES | CCn1c2c(c3cc(C(=O)NCc4ccc5cc(NC)nc(N)c5c4)ccc31)CCCC2=O |
| InChI | InChI=1S/C26H27N5O2/c1-3-31-21-10-9-17(12-20(21)18-5-4-6-22(32)24(18)31)26(33)29-14-15-7-8-16-13-23(28-2)30-25(27)19(16)11-15/h7-13H,3-6,14H2,1-2H3,(H,29,33)(H3,27,28,30) |
| InChIKey | CRLVIKQSZGNUTR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|