C13H21NO — CID 172623163
3,5-dimethylfuro[3,2-b]pyridine;ethane (PubChem CID 172623163) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 3,5-dimethylfuro[3,2-b]pyridine;ethane.
| Compound Name | 3,5-dimethylfuro[3,2-b]pyridine;ethane |
|---|---|
| PubChem CID | 172623163 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 3,5-dimethylfuro[3,2-b]pyridine;ethane |
| SMILES | CC.CC.Cc1ccc2occ(C)c2n1 |
| InChI | InChI=1S/C9H9NO.2C2H6/c1-6-5-11-8-4-3-7(2)10-9(6)8;2*1-2/h3-5H,1-2H3;2*1-2H3 |
| InChIKey | CGSHRZDSNFESKR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |