C9H9N3O2 — CID 13193775
2-amino-5-methylfuro[3,2-b]pyridine-3-carboxamide (PubChem CID 13193775) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-amino-5-methylfuro[3,2-b]pyridine-3-carboxamide.
| Compound Name | 2-amino-5-methylfuro[3,2-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 13193775 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-amino-5-methylfuro[3,2-b]pyridine-3-carboxamide |
| SMILES | Cc1ccc2oc(N)c(C(N)=O)c2n1 |
| InChI | InChI=1S/C9H9N3O2/c1-4-2-3-5-7(12-4)6(8(10)13)9(11)14-5/h2-3H,11H2,1H3,(H2,10,13) |
| InChIKey | VPVDVWSPCSBWFZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |