C19H15BrClF2NO2 — CID 172625713
2-bromo-2-(4-chlorophenyl)-1-[6-(difluoromethoxy)spiro[2H-indole-3,1'-cyclopropane]-1-yl]ethanone (PubChem CID 172625713) has the molecular formula C19H15BrClF2NO2 and a molecular weight of 442.69 g/mol. Its IUPAC name is 2-bromo-2-(4-chlorophenyl)-1-[6-(difluoromethoxy)spiro[2H-indole-3,1'-cyclopropane]-1-yl]ethanone.
| Compound Name | 2-bromo-2-(4-chlorophenyl)-1-[6-(difluoromethoxy)spiro[2H-indole-3,1'-cyclopropane]-1-yl]ethanone |
|---|---|
| PubChem CID | 172625713 |
| Molecular Formula | C19H15BrClF2NO2 |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | 2-bromo-2-(4-chlorophenyl)-1-[6-(difluoromethoxy)spiro[2H-indole-3,1'-cyclopropane]-1-yl]ethanone |
| SMILES | O=C(C(Br)c1ccc(Cl)cc1)N1CC2(CC2)c2ccc(OC(F)F)cc21 |
| InChI | InChI=1S/C19H15BrClF2NO2/c20-16(11-1-3-12(21)4-2-11)17(25)24-10-19(7-8-19)14-6-5-13(9-15(14)24)26-18(22)23/h1-6,9,16,18H,7-8,10H2 |
| InChIKey | WOOAFAONKVVDAQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|