C19H14BrClF3NO — CID 172625768
2-bromo-2-(4-chlorophenyl)-1-[6-(trifluoromethyl)spiro[2H-indole-3,1'-cyclopropane]-1-yl]ethanone (PubChem CID 172625768) has the molecular formula C19H14BrClF3NO and a molecular weight of 444.68 g/mol. Its IUPAC name is 2-bromo-2-(4-chlorophenyl)-1-[6-(trifluoromethyl)spiro[2H-indole-3,1'-cyclopropane]-1-yl]ethanone.
| Compound Name | 2-bromo-2-(4-chlorophenyl)-1-[6-(trifluoromethyl)spiro[2H-indole-3,1'-cyclopropane]-1-yl]ethanone |
|---|---|
| PubChem CID | 172625768 |
| Molecular Formula | C19H14BrClF3NO |
| Molecular Weight | 444.68 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | 2-bromo-2-(4-chlorophenyl)-1-[6-(trifluoromethyl)spiro[2H-indole-3,1'-cyclopropane]-1-yl]ethanone |
| SMILES | O=C(C(Br)c1ccc(Cl)cc1)N1CC2(CC2)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C19H14BrClF3NO/c20-16(11-1-4-13(21)5-2-11)17(26)25-10-18(7-8-18)14-6-3-12(9-15(14)25)19(22,23)24/h1-6,9,16H,7-8,10H2 |
| InChIKey | HOXUTJQINJRYSI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|