C17H12BrClF3NO — CID 131964335
2-bromo-2-(4-chlorophenyl)-1-[6-(trifluoromethyl)-2,3-dihydroindol-1-yl]ethanone (PubChem CID 131964335) has the molecular formula C17H12BrClF3NO and a molecular weight of 418.64 g/mol. Its IUPAC name is 2-bromo-2-(4-chlorophenyl)-1-[6-(trifluoromethyl)-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 2-bromo-2-(4-chlorophenyl)-1-[6-(trifluoromethyl)-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 131964335 |
| Molecular Formula | C17H12BrClF3NO |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | 2-bromo-2-(4-chlorophenyl)-1-[6-(trifluoromethyl)-2,3-dihydroindol-1-yl]ethanone |
| SMILES | O=C(C(Br)c1ccc(Cl)cc1)N1CCc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C17H12BrClF3NO/c18-15(11-2-5-13(19)6-3-11)16(24)23-8-7-10-1-4-12(9-14(10)23)17(20,21)22/h1-6,9,15H,7-8H2 |
| InChIKey | RRTXSYYNUIEUJC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|