C16H18BrIN2O2 — CID 172628239
2-bromo-N-(1-methoxy-1λ3-iodinan-4-yl)quinoline-4-carboxamide (PubChem CID 172628239) has the molecular formula C16H18BrIN2O2 and a molecular weight of 477.14 g/mol. Its IUPAC name is 2-bromo-N-(1-methoxy-1λ3-iodinan-4-yl)quinoline-4-carboxamide.
| Compound Name | 2-bromo-N-(1-methoxy-1λ3-iodinan-4-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 172628239 |
| Molecular Formula | C16H18BrIN2O2 |
| Molecular Weight | 477.14 g/mol |
| Exact Mass | 475.96 |
| IUPAC Name | 2-bromo-N-(1-methoxy-1λ3-iodinan-4-yl)quinoline-4-carboxamide |
| SMILES | COI1CCC(NC(=O)c2cc(Br)nc3ccccc23)CC1 |
| InChI | InChI=1S/C16H18BrIN2O2/c1-22-18-8-6-11(7-9-18)19-16(21)13-10-15(17)20-14-5-3-2-4-12(13)14/h2-5,10-11H,6-9H2,1H3,(H,19,21) |
| InChIKey | ABYMCJBUJZFNEW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.14 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|