About molecular hydrogen;7-propan-2-yl-1H-pyrazolo[5,4-c]pyridine
molecular hydrogen;7-propan-2-yl-1H-pyrazolo[5,4-c]pyridine (PubChem CID 172629837) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is molecular hydrogen;7-propan-2-yl-1H-pyrazolo[5,4-c]pyridine.
Analyze molecular hydrogen;7-propan-2-yl-1H-pyrazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;7-propan-2-yl-1H-pyrazolo[5,4-c]pyridine?
The IUPAC name of molecular hydrogen;7-propan-2-yl-1H-pyrazolo[5,4-c]pyridine (CID 172629837) is molecular hydrogen;7-propan-2-yl-1H-pyrazolo[5,4-c]pyridine.
What is the SMILES notation for molecular hydrogen;7-propan-2-yl-1H-pyrazolo[5,4-c]pyridine?
The canonical SMILES for molecular hydrogen;7-propan-2-yl-1H-pyrazolo[5,4-c]pyridine is CC(C)c1nccc2cn[nH]c12.[H][H].
What is the InChIKey of molecular hydrogen;7-propan-2-yl-1H-pyrazolo[5,4-c]pyridine?
The InChIKey is ACZRDPXZULRAFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3.H2/c1-6(2)8-9-7(3-4-10-8)5-11-12-9;/h3-6H,1-2H3,(H,11,12);1H.
What are the key properties of molecular hydrogen;7-propan-2-yl-1H-pyrazolo[5,4-c]pyridine?
molecular hydrogen;7-propan-2-yl-1H-pyrazolo[5,4-c]pyridine has a molecular weight of 163.22 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;7-propan-2-yl-1H-pyrazolo[5,4-c]pyridine is sourced from PubChem (CID 172629837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).