C25H35N3O5 — CID 172630454
tert-butyl 2-[4-[4-[(3S)-2,6-dioxopiperidin-3-yl]phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]acetate (PubChem CID 172630454) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-[(3S)-2,6-dioxopiperidin-3-yl]phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]acetate.
| Compound Name | tert-butyl 2-[4-[4-[(3S)-2,6-dioxopiperidin-3-yl]phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]acetate |
|---|---|
| PubChem CID | 172630454 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | tert-butyl 2-[4-[4-[(3S)-2,6-dioxopiperidin-3-yl]phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCC2(CC1)CN(c1ccc([C@@H]3CCC(=O)NC3=O)cc1)CCO2 |
| InChI | InChI=1S/C25H35N3O5/c1-24(2,3)33-22(30)16-27-12-10-25(11-13-27)17-28(14-15-32-25)19-6-4-18(5-7-19)20-8-9-21(29)26-23(20)31/h4-7,20H,8-17H2,1-3H3,(H,26,29,31)/t20-/m0/s1 |
| InChIKey | RUXLHUMTOMIZRH-FQEVSTJZSA-N |
| XLogP | 2.22 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|