C21H27N3O5 — CID 172630884
2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]acetic acid (PubChem CID 172630884) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]acetic acid.
| Compound Name | 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]acetic acid |
|---|---|
| PubChem CID | 172630884 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]acetic acid |
| SMILES | O=C(O)CN1CCC2(CC1)CN(c1ccc(C3CCC(=O)NC3=O)cc1)CCO2 |
| InChI | InChI=1S/C21H27N3O5/c25-18-6-5-17(20(28)22-18)15-1-3-16(4-2-15)24-11-12-29-21(14-24)7-9-23(10-8-21)13-19(26)27/h1-4,17H,5-14H2,(H,26,27)(H,22,25,28) |
| InChIKey | ADDISZYKVMMMOX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|